In which reaction does water act as a reactant?

Electrophilic addition reaction

What chemical reaction produces wine and beer?

Hydroboration-oxidation reaction

Who developed the ancient atomic theory?

Thucydides and Heraclides Ponticus

Which reaction involves the halogenation of carboxylic acids at the alpha (α) carbon?

Hell-Volhard-Zelinskii reaction

Types of Chemical Reactions Quiz Quiz

19.

Who introduced the proton theory of acids and bases?

Jerome Karle and Herbert A. Hauptman

Johannes Nicolaus Brønsted and Thomas Martin Lowry

Gerty Theresa Radnitz and Carl Ferinand Cori

Dmitri Mendeleev and Julius Lothar Meyer

1. S + O2 → SO2

2. 2H2O → 2H2 + O2

3. Zn + 2HCl → H2 + ZnCl2

4. HCl + NaOH → NaCl + H2O

5. 2Na + 2H2O → 2NaOH + H2

6. 2Na + Cl2 → 2NaCl

7. CaCO3 + 2HCl → CaCl2 + H2CO3

8. CaCO3 → CaO + CO2

9. What chemical reaction causes corrosion of iron?

10. What type of chemical reaction happens in burning a matchstick?

11. In which reaction does water act as a reactant?

12. What chemical reaction uses direct electric current to drive chemical reaction?

13. What chemical reaction causes rancidity in food?

14. What is the ratio of reactants and products in a chemical reaction called?

15. What is the molecular formula of ethanol?

16. In which process does a substance absorb moisture from the atmosphere?

17. What substance causes a chemical reaction without itself being affected?

18. Name the substance that causes a foaming action in doughs and batters.

19. Who introduced the proton theory of acids and bases?

20. What chemical reaction is involved in the production of soap?

21. What reaction of alkoxide ions with alkyl halides gives ether?

22. What chemical reaction produces wine and beer?

23. What is the molecular formula of glucose?

24. What law states that a compound is always composed of the same elements by mass?

25. What is the molecular formula of hematite?

26. What is the ratio of the volume of hydrogen and oxygen present in water?

27. What chemical is formed when water reacts with sulfur trioxide?

28. Who developed the ancient atomic theory?

29. What is the conversion of butane to isobutane called?

30. What acid's formula is CH3(CH2)7CH=CH(CH2)7CO2HH?

31. Pb1SO4 is the chemical formula of which of the following elements?

32. What is the other name for quick lime?

33. What reaction involves the absorption of energy to form new products?

34. In which reaction does a compound break down into simpler substances?

35. With whom did Victor Grignard win the Nobel Prize for Chemistry in 1912 for discovering the use of nickel as a catalyst in hydrogenation?

36. In which reaction does the treatment of amide with bromine and alkali give a primary amine?

37. How many types of substitution reactions are there?

38. What is the reaction that adds monomer molecules together to form chains?

39. Which of the following is known as slaked lime?

40. In which reaction is ozone employed to cleave the unsaturated compounds?

41. Who coined the term "ester"?

42. What is the branch of chemistry which deals with the study of chemical reaction rate?

43. Which chemical reaction is caused by the absorption of light energy?

44. Which compound is represented by the generic formula RMgX?

45. Which reaction involves the halogenation of carboxylic acids at the alpha (α) carbon?

46. What reaction is formed when benzaldehyde is treated with a concentrated base?

47. Name the product formed by the ammoxidation of propene and ammonia?

48. What is the final product of nitration of toluene?

49. What is the common name of sodium carbonate decahydrate?

50. Which compound is generated in certain foods as a result of cooking at high temperatures?

51. C8H8 is the chemical formula of which compound?

52. Name the hydrocarbon that contains at least one carbon-to-carbon double bond?

53. Which formula represents the relative ratios of different atoms in a compound?

54. Which chemical process combines light, gaseous hydrocarbons to produce high-octane components of gasoline?

55. A redox reaction is one in which...

56. Who proposed the concept of acid and base based on the theory of ionization?

57. Which is the earliest sandwich compound?

58. What reaction takes place between molecular hydrogen and an element or compound in the presence of a catalyst?

Time

Report Question

Support mcqmojo.com by disabling your adblocker.

1.

S + O₂ → SO₂

2.

2H₂O → 2H₂ + O₂

3.

Zn + 2HCl → H₂ + ZnCl₂

4.

HCl + NaOH → NaCl + H₂O

5.

2Na + 2H₂O → 2NaOH + H₂

6.

2Na + Cl₂ → 2NaCl

7.

CaCO₃ + 2HCl → CaCl₂ + H₂CO₃

8.

CaCO₃ → CaO + CO₂

9.

What chemical reaction causes corrosion of iron?

10.

What type of chemical reaction happens in burning a matchstick?

11.

In which reaction does water act as a reactant?

12.

What chemical reaction uses direct electric current to drive chemical reaction?

13.

What chemical reaction causes rancidity in food?

14.

What is the ratio of reactants and products in a chemical reaction called?

15.

What is the molecular formula of ethanol?

16.

In which process does a substance absorb moisture from the atmosphere?

17.

What substance causes a chemical reaction without itself being affected?

18.

Name the substance that causes a foaming action in doughs and batters.

19.

Who introduced the proton theory of acids and bases?

20.

What chemical reaction is involved in the production of soap?

21.

What reaction of alkoxide ions with alkyl halides gives ether?

22.

What chemical reaction produces wine and beer?

23.

What is the molecular formula of glucose?

24.

What law states that a compound is always composed of the same elements by mass?

25.

What is the molecular formula of hematite?

26.

What is the ratio of the volume of hydrogen and oxygen present in water?

27.

What chemical is formed when water reacts with sulfur trioxide?

28.

Who developed the ancient atomic theory?

29.

What is the conversion of butane to isobutane called?

30.

What acid's formula is CH₃(CH₂)₇CH=CH(CH₂)₇CO₂HH?

31.

Pb₁SO₄ is the chemical formula of which of the following elements?

32.

What is the other name for quick lime?

33.

What reaction involves the absorption of energy to form new products?

34.

In which reaction does a compound break down into simpler substances?

35.

With whom did Victor Grignard win the Nobel Prize for Chemistry in 1912 for discovering the use of nickel as a catalyst in hydrogenation?

36.

In which reaction does the treatment of amide with bromine and alkali give a primary amine?

37.

How many types of substitution reactions are there?

38.

What is the reaction that adds monomer molecules together to form chains?

39.

Which of the following is known as slaked lime?

40.

In which reaction is ozone employed to cleave the unsaturated compounds?

41.

Who coined the term "ester"?

42.

What is the branch of chemistry which deals with the study of chemical reaction rate?

43.

Which chemical reaction is caused by the absorption of light energy?

44.

Which compound is represented by the generic formula RMgX?

45.

Which reaction involves the halogenation of carboxylic acids at the alpha (α) carbon?

46.

What reaction is formed when benzaldehyde is treated with a concentrated base?

47.

Name the product formed by the ammoxidation of propene and ammonia?

48.

What is the final product of nitration of toluene?

49.

What is the common name of sodium carbonate decahydrate?

50.

Which compound is generated in certain foods as a result of cooking at high temperatures?

51.

C₈H₈ is the chemical formula of which compound?

52.

Name the hydrocarbon that contains at least one carbon-to-carbon double bond?

53.

Which formula represents the relative ratios of different atoms in a compound?

54.

Which chemical process combines light, gaseous hydrocarbons to produce high-octane components of gasoline?

55.

A redox reaction is one in which...

56.

Who proposed the concept of acid and base based on the theory of ionization?

57.

Which is the earliest sandwich compound?

58.

What reaction takes place between molecular hydrogen and an element or compound in the presence of a catalyst?